C28H27N3O6 — CID 24818262
methyl 4-[(3Z)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate (PubChem CID 24818262) has the molecular formula C28H27N3O6 and a molecular weight of 501.54 g/mol. Its IUPAC name is methyl 4-[(3Z)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
|---|---|
| PubChem CID | 24818262 |
| Molecular Formula | C28H27N3O6 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | methyl 4-[(3Z)-3-[hydroxy-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)methylidene]-1-(3-imidazol-1-ylpropyl)-4,5-dioxopyrrolidin-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C2/C(=C(/O)c3ccc4c(c3)CC(C)O4)C(=O)C(=O)N2CCCn2ccnc2)cc1 |
| InChI | InChI=1S/C28H27N3O6/c1-17-14-21-15-20(8-9-22(21)37-17)25(32)23-24(18-4-6-19(7-5-18)28(35)36-2)31(27(34)26(23)33)12-3-11-30-13-10-29-16-30/h4-10,13,15-17,24,32H,3,11-12,14H2,1-2H3/b25-23- |
| InChIKey | BRDNHAQYKJKELN-BZZOAKBMSA-N |
| XLogP | 3.51 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|