C17H21NO2 — CID 24818395
3-methyl-N-(2-methylcyclohexyl)-1-benzofuran-2-carboxamide (PubChem CID 24818395) has the molecular formula C17H21NO2 and a molecular weight of 271.35 g/mol. Its IUPAC name is 3-methyl-N-(2-methylcyclohexyl)-1-benzofuran-2-carboxamide.
| Compound Name | 3-methyl-N-(2-methylcyclohexyl)-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 24818395 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.35 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 3-methyl-N-(2-methylcyclohexyl)-1-benzofuran-2-carboxamide |
| SMILES | CC1CCCCC1NC(=O)C2=C(C3=CC=CC=C3O2)C |
| InChI | InChI=1S/C17H21NO2/c1-11-7-3-5-9-14(11)18-17(19)16-12(2)13-8-4-6-10-15(13)20-16/h4,6,8,10-11,14H,3,5,7,9H2,1-2H3,(H,18,19) |
| InChIKey | OJJVRDWVTRQDPI-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 42.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | 357 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.35 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |