C25H33N3O3 — CID 24818401
N-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]-4-butoxybenzamide (PubChem CID 24818401) has the molecular formula C25H33N3O3 and a molecular weight of 423.56 g/mol. Its IUPAC name is N-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]-4-butoxybenzamide.
| Compound Name | N-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]-4-butoxybenzamide |
|---|---|
| PubChem CID | 24818401 |
| Molecular Formula | C25H33N3O3 |
| Molecular Weight | 423.56 g/mol |
| Exact Mass | 423.25 |
| IUPAC Name | N-[2-[(1-benzylpiperidin-4-yl)amino]-2-oxoethyl]-4-butoxybenzamide |
| SMILES | CCCCOc1ccc(C(=O)NCC(=O)NC2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O3/c1-2-3-17-31-23-11-9-21(10-12-23)25(30)26-18-24(29)27-22-13-15-28(16-14-22)19-20-7-5-4-6-8-20/h4-12,22H,2-3,13-19H2,1H3,(H,26,30)(H,27,29) |
| InChIKey | LCNQBCVJISDJER-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|