C18H20N2O — CID 24818459
N-(3,4-dimethylphenyl)-3,4-dihydro-2H-quinoline-1-carboxamide (PubChem CID 24818459) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is N-(3,4-dimethylphenyl)-3,4-dihydro-2H-quinoline-1-carboxamide.
| Compound Name | N-(3,4-dimethylphenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 24818459 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | N-(3,4-dimethylphenyl)-3,4-dihydro-2H-quinoline-1-carboxamide |
| SMILES | Cc1ccc(NC(=O)N2CCCc3ccccc32)cc1C |
| InChI | InChI=1S/C18H20N2O/c1-13-9-10-16(12-14(13)2)19-18(21)20-11-5-7-15-6-3-4-8-17(15)20/h3-4,6,8-10,12H,5,7,11H2,1-2H3,(H,19,21) |
| InChIKey | FDCKLUJNIZJPFT-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |