About 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea
1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea (PubChem CID 24818584) has the molecular formula C17H18N2O5
and a molecular weight of 330.34 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea |
| PubChem CID | 24818584 |
| Molecular Formula | C17H18N2O5 |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C17H18N2O5/c1-21-13-6-4-12(8-15(13)22-2)19-17(20)18-9-11-3-5-14-16(7-11)24-10-23-14/h3-8H,9-10H2,1-2H3,(H2,18,19,20) |
| InChIKey | DRUWJGPBHOBAJK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea?
The IUPAC name of 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea (CID 24818584) is 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea.
What is the SMILES notation for 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea?
The canonical SMILES for 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea is COc1ccc(NC(=O)NCc2ccc3c(c2)OCO3)cc1OC.
What is the InChIKey of 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea?
The InChIKey is DRUWJGPBHOBAJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O5/c1-21-13-6-4-12(8-15(13)22-2)19-17(20)18-9-11-3-5-14-16(7-11)24-10-23-14/h3-8H,9-10H2,1-2H3,(H2,18,19,20).
What are the key properties of 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea?
1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea has a molecular weight of 330.34 g/mol, XLogP of 2.75, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzodioxol-5-ylmethyl)-3-(3,4-dimethoxyphenyl)urea is sourced from PubChem (CID 24818584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).