C11H13N5O — CID 24818641
1-(2,4-dimethylphenyl)-3-(1,2,4-triazol-4-yl)urea (PubChem CID 24818641) has the molecular formula C11H13N5O and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-(2,4-dimethylphenyl)-3-(1,2,4-triazol-4-yl)urea.
| Compound Name | 1-(2,4-dimethylphenyl)-3-(1,2,4-triazol-4-yl)urea |
|---|---|
| PubChem CID | 24818641 |
| Molecular Formula | C11H13N5O |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | 1-(2,4-dimethylphenyl)-3-(1,2,4-triazol-4-yl)urea |
| SMILES | Cc1ccc(NC(=O)Nn2cnnc2)c(C)c1 |
| InChI | InChI=1S/C11H13N5O/c1-8-3-4-10(9(2)5-8)14-11(17)15-16-6-12-13-7-16/h3-7H,1-2H3,(H2,14,15,17) |
| InChIKey | LZLBTHDABYEIBC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |