About N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide
N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide (PubChem CID 24818932) has the molecular formula C23H38N4O
and a molecular weight of 386.58 g/mol. Its IUPAC name is N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide.
Molecular Properties
| Compound Name | N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide |
| PubChem CID | 24818932 |
| Molecular Formula | C23H38N4O |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.30 |
| IUPAC Name | N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide |
| SMILES | CC(C)=CCCC(C)CN1CCC(n2nccc2NC(=O)C2CCCC2)CC1 |
| InChI | InChI=1S/C23H38N4O/c1-18(2)7-6-8-19(3)17-26-15-12-21(13-16-26)27-22(11-14-24-27)25-23(28)20-9-4-5-10-20/h7,11,14,19-21H,4-6,8-10,12-13,15-17H2,1-3H3,(H,25,28) |
| InChIKey | PQQSODSHSPUXBC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide?
The IUPAC name of N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide (CID 24818932) is N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide.
What is the SMILES notation for N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide?
The canonical SMILES for N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide is CC(C)=CCCC(C)CN1CCC(n2nccc2NC(=O)C2CCCC2)CC1.
What is the InChIKey of N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide?
The InChIKey is PQQSODSHSPUXBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H38N4O/c1-18(2)7-6-8-19(3)17-26-15-12-21(13-16-26)27-22(11-14-24-27)25-23(28)20-9-4-5-10-20/h7,11,14,19-21H,4-6,8-10,12-13,15-17H2,1-3H3,(H,25,28).
What are the key properties of N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide?
N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide has a molecular weight of 386.58 g/mol, XLogP of 5.03, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[1-(2,6-dimethylhept-5-enyl)piperidin-4-yl]pyrazol-3-yl]cyclopentanecarboxamide is sourced from PubChem (CID 24818932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).