About 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide
7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide (PubChem CID 24818990) has the molecular formula C18H17FN2O2
and a molecular weight of 312.34 g/mol. Its IUPAC name is 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide.
Molecular Properties
| Compound Name | 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide |
| PubChem CID | 24818990 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide |
| SMILES | Cc1c(C(=O)N(C)C(C)c2ccccn2)oc2c(F)cccc12 |
| InChI | InChI=1S/C18H17FN2O2/c1-11-13-7-6-8-14(19)17(13)23-16(11)18(22)21(3)12(2)15-9-4-5-10-20-15/h4-10,12H,1-3H3 |
| InChIKey | IUUGQJNVRBHVRI-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide?
The IUPAC name of 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide (CID 24818990) is 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide.
What is the SMILES notation for 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide?
The canonical SMILES for 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide is Cc1c(C(=O)N(C)C(C)c2ccccn2)oc2c(F)cccc12.
What is the InChIKey of 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide?
The InChIKey is IUUGQJNVRBHVRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17FN2O2/c1-11-13-7-6-8-14(19)17(13)23-16(11)18(22)21(3)12(2)15-9-4-5-10-20-15/h4-10,12H,1-3H3.
What are the key properties of 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide?
7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide has a molecular weight of 312.34 g/mol, XLogP of 4.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-N,3-dimethyl-N-(1-pyridin-2-ylethyl)-1-benzofuran-2-carboxamide is sourced from PubChem (CID 24818990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).