About ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate
ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate (PubChem CID 24819056) has the molecular formula C20H21NO4S
and a molecular weight of 371.46 g/mol. Its IUPAC name is ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate |
| PubChem CID | 24819056 |
| Molecular Formula | C20H21NO4S |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate |
| SMILES | CCOC(=O)/C=C1\CN(C(C)c2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C20H21NO4S/c1-3-25-20(22)13-17-14-21(15(2)16-9-5-4-6-10-16)26(23,24)19-12-8-7-11-18(17)19/h4-13,15H,3,14H2,1-2H3/b17-13+ |
| InChIKey | RUPYBEHTVBRXLZ-GHRIWEEISA-N |
| XLogP | 3.40 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate?
The IUPAC name of ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate (CID 24819056) is ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate.
What is the SMILES notation for ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate?
The canonical SMILES for ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate is CCOC(=O)/C=C1\CN(C(C)c2ccccc2)S(=O)(=O)c2ccccc21.
What is the InChIKey of ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate?
The InChIKey is RUPYBEHTVBRXLZ-GHRIWEEISA-N. The full InChI is InChI=1S/C20H21NO4S/c1-3-25-20(22)13-17-14-21(15(2)16-9-5-4-6-10-16)26(23,24)19-12-8-7-11-18(17)19/h4-13,15H,3,14H2,1-2H3/b17-13+.
What are the key properties of ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate?
ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate has a molecular weight of 371.46 g/mol, XLogP of 3.40, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2Z)-2-[1,1-dioxo-2-(1-phenylethyl)-3H-1λ6,2-benzothiazin-4-ylidene]acetate is sourced from PubChem (CID 24819056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).