C19H20F2N2O3 — CID 24819331
N-[2-(cyclohexen-1-yl)ethyl]-5-[(2,6-difluorophenoxy)methyl]-1,2-oxazole-3-carboxamide (PubChem CID 24819331) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-5-[(2,6-difluorophenoxy)methyl]-1,2-oxazole-3-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[(2,6-difluorophenoxy)methyl]-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 24819331 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-5-[(2,6-difluorophenoxy)methyl]-1,2-oxazole-3-carboxamide |
| SMILES | O=C(NCCC1=CCCCC1)c1cc(COc2c(F)cccc2F)on1 |
| InChI | InChI=1S/C19H20F2N2O3/c20-15-7-4-8-16(21)18(15)25-12-14-11-17(23-26-14)19(24)22-10-9-13-5-2-1-3-6-13/h4-5,7-8,11H,1-3,6,9-10,12H2,(H,22,24) |
| InChIKey | QTYHSZABOKQGMQ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|