About 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea
1-benzhydryl-3-(2,4-dimethoxyphenyl)urea (PubChem CID 24819711) has the molecular formula C22H22N2O3
and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea.
Molecular Properties
| Compound Name | 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea |
| PubChem CID | 24819711 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC(c2ccccc2)c2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C22H22N2O3/c1-26-18-13-14-19(20(15-18)27-2)23-22(25)24-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,21H,1-2H3,(H2,23,24,25) |
| InChIKey | HJJHWGZBWJSHNG-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea?
The IUPAC name of 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea (CID 24819711) is 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea.
What is the SMILES notation for 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea?
The canonical SMILES for 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea is COc1ccc(NC(=O)NC(c2ccccc2)c2ccccc2)c(OC)c1.
What is the InChIKey of 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea?
The InChIKey is HJJHWGZBWJSHNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22N2O3/c1-26-18-13-14-19(20(15-18)27-2)23-22(25)24-21(16-9-5-3-6-10-16)17-11-7-4-8-12-17/h3-15,21H,1-2H3,(H2,23,24,25).
What are the key properties of 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea?
1-benzhydryl-3-(2,4-dimethoxyphenyl)urea has a molecular weight of 362.43 g/mol, XLogP of 4.61, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryl-3-(2,4-dimethoxyphenyl)urea is sourced from PubChem (CID 24819711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).