About [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate (PubChem CID 24819854) has the molecular formula C23H27NO7S
and a molecular weight of 461.54 g/mol. Its IUPAC name is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate.
Molecular Properties
| Compound Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
| PubChem CID | 24819854 |
| Molecular Formula | C23H27NO7S |
| Molecular Weight | 461.54 g/mol |
| Exact Mass | 461.15 |
| IUPAC Name | [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
| SMILES | COc1ccc(C(=O)COC(=O)C(CCSC)NC(=O)COc2ccccc2)c(OC)c1 |
| InChI | InChI=1S/C23H27NO7S/c1-28-17-9-10-18(21(13-17)29-2)20(25)14-31-23(27)19(11-12-32-3)24-22(26)15-30-16-7-5-4-6-8-16/h4-10,13,19H,11-12,14-15H2,1-3H3,(H,24,26) |
| InChIKey | OJAQKXGAYYILKN-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 461.54 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate?
The IUPAC name of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate (CID 24819854) is [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate.
What is the SMILES notation for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate?
The canonical SMILES for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate is COc1ccc(C(=O)COC(=O)C(CCSC)NC(=O)COc2ccccc2)c(OC)c1.
What is the InChIKey of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate?
The InChIKey is OJAQKXGAYYILKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO7S/c1-28-17-9-10-18(21(13-17)29-2)20(25)14-31-23(27)19(11-12-32-3)24-22(26)15-30-16-7-5-4-6-8-16/h4-10,13,19H,11-12,14-15H2,1-3H3,(H,24,26).
What are the key properties of [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate?
[2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate has a molecular weight of 461.54 g/mol, XLogP of 2.75, 13 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,4-dimethoxyphenyl)-2-oxoethyl] 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate is sourced from PubChem (CID 24819854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).