About [(2S)-oxiran-2-yl]methyl acetate
[(2S)-oxiran-2-yl]methyl acetate (PubChem CID 24820386) has the molecular formula C5H8O3
and a molecular weight of 116.12 g/mol. Its IUPAC name is [(2S)-oxiran-2-yl]methyl acetate.
Molecular Properties
| Compound Name | [(2S)-oxiran-2-yl]methyl acetate |
| PubChem CID | 24820386 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | [(2S)-oxiran-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@@H]1CO1 |
| InChI | InChI=1S/C5H8O3/c1-4(6)7-2-5-3-8-5/h5H,2-3H2,1H3/t5-/m1/s1 |
| InChIKey | JKXONPYJVWEAEL-RXMQYKEDSA-N |
| XLogP | -0.05 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-oxiran-2-yl]methyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-oxiran-2-yl]methyl acetate?
The IUPAC name of [(2S)-oxiran-2-yl]methyl acetate (CID 24820386) is [(2S)-oxiran-2-yl]methyl acetate.
What is the SMILES notation for [(2S)-oxiran-2-yl]methyl acetate?
The canonical SMILES for [(2S)-oxiran-2-yl]methyl acetate is CC(=O)OC[C@@H]1CO1.
What is the InChIKey of [(2S)-oxiran-2-yl]methyl acetate?
The InChIKey is JKXONPYJVWEAEL-RXMQYKEDSA-N. The full InChI is InChI=1S/C5H8O3/c1-4(6)7-2-5-3-8-5/h5H,2-3H2,1H3/t5-/m1/s1.
What are the key properties of [(2S)-oxiran-2-yl]methyl acetate?
[(2S)-oxiran-2-yl]methyl acetate has a molecular weight of 116.12 g/mol, XLogP of -0.05, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-oxiran-2-yl]methyl acetate is sourced from PubChem (CID 24820386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).