C11H19NO4 — CID 24820687
(E,3S)-3-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxohept-5-enoic acid (PubChem CID 24820687) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (E,3S)-3-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxohept-5-enoic acid.
| Compound Name | (E,3S)-3-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxohept-5-enoic acid |
|---|---|
| PubChem CID | 24820687 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (E,3S)-3-amino-7-[(2-methylpropan-2-yl)oxy]-7-oxohept-5-enoic acid |
| SMILES | CC(C)(C)OC(=O)/C=C/C[C@H](N)CC(=O)O |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)6-4-5-8(12)7-9(13)14/h4,6,8H,5,7,12H2,1-3H3,(H,13,14)/b6-4+/t8-/m0/s1 |
| InChIKey | YYFVXGPIMLGAEQ-JQTRYQTASA-N |
| XLogP | 1.08 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|