C22H31ClFNO4 — CID 24820728
(8S,10S,13S,14S,17R)-17-(2-aminoacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;hydrochloride (PubChem CID 24820728) has the molecular formula C22H31ClFNO4 and a molecular weight of 427.94 g/mol. Its IUPAC name is (8S,10S,13S,14S,17R)-17-(2-aminoacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;hydrochloride.
| Compound Name | (8S,10S,13S,14S,17R)-17-(2-aminoacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;hydrochloride |
|---|---|
| PubChem CID | 24820728 |
| Molecular Formula | C22H31ClFNO4 |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | (8S,10S,13S,14S,17R)-17-(2-aminoacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one;hydrochloride |
| SMILES | CC1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@]4(C)C3(F)C(O)C[C@]2(C)[C@@]1(O)C(=O)CN.Cl |
| InChI | InChI=1S/C22H30FNO4.ClH/c1-12-8-16-15-5-4-13-9-14(25)6-7-19(13,2)21(15,23)17(26)10-20(16,3)22(12,28)18(27)11-24;/h6-7,9,12,15-17,26,28H,4-5,8,10-11,24H2,1-3H3;1H/t12?,15-,16-,17?,19-,20-,21?,22-;/m0./s1 |
| InChIKey | AETGVMDUKQYTQU-CQIRMVKISA-N |
| XLogP | 2.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |