C17H19N3O3 — CID 24820792
1'-(cyclohexylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820792) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1'-(cyclohexylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-(cyclohexylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820792 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 1'-(cyclohexylmethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)N(CC1CCCCC1)c1ccccc12 |
| InChI | InChI=1S/C17H19N3O3/c21-14-17(19-16(23)18-14)12-8-4-5-9-13(12)20(15(17)22)10-11-6-2-1-3-7-11/h4-5,8-9,11H,1-3,6-7,10H2,(H2,18,19,21,23) |
| InChIKey | PKAOQHONGIBSMO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|