C14H12FN3O3 — CID 24820816
1'-(cyclopropylmethyl)-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820816) has the molecular formula C14H12FN3O3 and a molecular weight of 289.27 g/mol. Its IUPAC name is 1'-(cyclopropylmethyl)-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-(cyclopropylmethyl)-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820816 |
| Molecular Formula | C14H12FN3O3 |
| Molecular Weight | 289.27 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 1'-(cyclopropylmethyl)-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)N(CC1CC1)c1ccc(F)cc12 |
| InChI | InChI=1S/C14H12FN3O3/c15-8-3-4-10-9(5-8)14(11(19)16-13(21)17-14)12(20)18(10)6-7-1-2-7/h3-5,7H,1-2,6H2,(H2,16,17,19,21) |
| InChIKey | GNXXZPFZPIASTF-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.27 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|