C16H13FN4O3 — CID 24820818
5'-fluoro-1'-(2-pyrrol-1-ylethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820818) has the molecular formula C16H13FN4O3 and a molecular weight of 328.30 g/mol. Its IUPAC name is 5'-fluoro-1'-(2-pyrrol-1-ylethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 5'-fluoro-1'-(2-pyrrol-1-ylethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820818 |
| Molecular Formula | C16H13FN4O3 |
| Molecular Weight | 328.30 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | 5'-fluoro-1'-(2-pyrrol-1-ylethyl)spiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)N(CCn1cccc1)c1ccc(F)cc12 |
| InChI | InChI=1S/C16H13FN4O3/c17-10-3-4-12-11(9-10)16(13(22)18-15(24)19-16)14(23)21(12)8-7-20-5-1-2-6-20/h1-6,9H,7-8H2,(H2,18,19,22,24) |
| InChIKey | SWKQHHWNVFRDLE-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 83.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|