C14H8ClFN4O3S — CID 24820824
1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820824) has the molecular formula C14H8ClFN4O3S and a molecular weight of 366.76 g/mol. Its IUPAC name is 1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820824 |
| Molecular Formula | C14H8ClFN4O3S |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 1'-[(2-chloro-1,3-thiazol-5-yl)methyl]-5'-fluorospiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | O=C1NC(=O)C2(N1)C(=O)N(Cc1cnc(Cl)s1)c1ccc(F)cc12 |
| InChI | InChI=1S/C14H8ClFN4O3S/c15-12-17-4-7(24-12)5-20-9-2-1-6(16)3-8(9)14(11(20)22)10(21)18-13(23)19-14/h1-4H,5H2,(H2,18,19,21,23) |
| InChIKey | CWGMHOGTONPUHU-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|