C18H13N5O4 — CID 24820871
1'-(2,1,3-benzoxadiazol-5-ylmethyl)-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione (PubChem CID 24820871) has the molecular formula C18H13N5O4 and a molecular weight of 363.33 g/mol. Its IUPAC name is 1'-(2,1,3-benzoxadiazol-5-ylmethyl)-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione.
| Compound Name | 1'-(2,1,3-benzoxadiazol-5-ylmethyl)-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
|---|---|
| PubChem CID | 24820871 |
| Molecular Formula | C18H13N5O4 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | 1'-(2,1,3-benzoxadiazol-5-ylmethyl)-5'-methylspiro[imidazolidine-5,3'-indole]-2,2',4-trione |
| SMILES | Cc1ccc2c(c1)C1(NC(=O)NC1=O)C(=O)N2Cc1ccc2nonc2c1 |
| InChI | InChI=1S/C18H13N5O4/c1-9-2-5-14-11(6-9)18(15(24)19-17(26)20-18)16(25)23(14)8-10-3-4-12-13(7-10)22-27-21-12/h2-7H,8H2,1H3,(H2,19,20,24,26) |
| InChIKey | LXRVXQXNHOCFFC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|