C26H24F3N3OS — CID 24821262
5-[[4-[3-[[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]phenyl]phenyl]methyl]-1,2,5-thiadiazolidin-3-one (PubChem CID 24821262) has the molecular formula C26H24F3N3OS and a molecular weight of 483.56 g/mol. Its IUPAC name is 5-[[4-[3-[[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]phenyl]phenyl]methyl]-1,2,5-thiadiazolidin-3-one.
| Compound Name | 5-[[4-[3-[[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]phenyl]phenyl]methyl]-1,2,5-thiadiazolidin-3-one |
|---|---|
| PubChem CID | 24821262 |
| Molecular Formula | C26H24F3N3OS |
| Molecular Weight | 483.56 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 5-[[4-[3-[[6-(trifluoromethyl)-3,4-dihydro-2H-quinolin-1-yl]methyl]phenyl]phenyl]methyl]-1,2,5-thiadiazolidin-3-one |
| SMILES | O=C1CN(Cc2ccc(-c3cccc(CN4CCCc5cc(C(F)(F)F)ccc54)c3)cc2)SN1 |
| InChI | InChI=1S/C26H24F3N3OS/c27-26(28,29)23-10-11-24-22(14-23)5-2-12-31(24)15-19-3-1-4-21(13-19)20-8-6-18(7-9-20)16-32-17-25(33)30-34-32/h1,3-4,6-11,13-14H,2,5,12,15-17H2,(H,30,33) |
| InChIKey | PJSBCVSRLIMGIN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.56 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|