C21H32N8O2 — CID 24821919
3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[[(3S)-pyrrolidin-3-yl]amino]-1,3,5-triazin-2-yl]amino]-N-hydroxy-4-methylbenzamide (PubChem CID 24821919) has the molecular formula C21H32N8O2 and a molecular weight of 428.54 g/mol. Its IUPAC name is 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[[(3S)-pyrrolidin-3-yl]amino]-1,3,5-triazin-2-yl]amino]-N-hydroxy-4-methylbenzamide.
| Compound Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[[(3S)-pyrrolidin-3-yl]amino]-1,3,5-triazin-2-yl]amino]-N-hydroxy-4-methylbenzamide |
|---|---|
| PubChem CID | 24821919 |
| Molecular Formula | C21H32N8O2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.26 |
| IUPAC Name | 3-[[4-[2,2-dimethylpropyl(methyl)amino]-6-[[(3S)-pyrrolidin-3-yl]amino]-1,3,5-triazin-2-yl]amino]-N-hydroxy-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NO)cc1Nc1nc(N[C@H]2CCNC2)nc(N(C)CC(C)(C)C)n1 |
| InChI | InChI=1S/C21H32N8O2/c1-13-6-7-14(17(30)28-31)10-16(13)24-19-25-18(23-15-8-9-22-11-15)26-20(27-19)29(5)12-21(2,3)4/h6-7,10,15,22,31H,8-9,11-12H2,1-5H3,(H,28,30)(H2,23,24,25,26,27)/t15-/m0/s1 |
| InChIKey | AELHYFBIBMMUDF-HNNXBMFYSA-N |
| XLogP | 2.30 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|