C30H34Cl2N4O2S — CID 24822178
(2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N,5-trimethylpyrrolidine-2-carboxamide (PubChem CID 24822178) has the molecular formula C30H34Cl2N4O2S and a molecular weight of 585.60 g/mol. Its IUPAC name is (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N,5-trimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N,5-trimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24822178 |
| Molecular Formula | C30H34Cl2N4O2S |
| Molecular Weight | 585.60 g/mol |
| Exact Mass | 584.18 |
| IUPAC Name | (2S,5S)-1-[(5R,6S)-5,6-bis(4-chlorophenyl)-6-methyl-3-propan-2-yl-5H-imidazo[2,1-b][1,3]thiazole-2-carbonyl]-N,N,5-trimethylpyrrolidine-2-carboxamide |
| SMILES | CC(C)C1=C(C(=O)N2[C@@H](C)CC[C@H]2C(=O)N(C)C)SC2=N[C@@](C)(c3ccc(Cl)cc3)[C@@H](c3ccc(Cl)cc3)N21 |
| InChI | InChI=1S/C30H34Cl2N4O2S/c1-17(2)24-25(28(38)35-18(3)7-16-23(35)27(37)34(5)6)39-29-33-30(4,20-10-14-22(32)15-11-20)26(36(24)29)19-8-12-21(31)13-9-19/h8-15,17-18,23,26H,7,16H2,1-6H3/t18-,23-,26+,30-/m0/s1 |
| InChIKey | UNTCOZBAKHHRQE-LAYJHPSDSA-N |
| XLogP | 6.70 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |