C12H16O4 — CID 24822731
(1S,5R,6S)-5-hydroxy-3-[(E)-3-methoxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one (PubChem CID 24822731) has the molecular formula C12H16O4 and a molecular weight of 224.26 g/mol. Its IUPAC name is (1S,5R,6S)-5-hydroxy-3-[(E)-3-methoxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one.
| Compound Name | (1S,5R,6S)-5-hydroxy-3-[(E)-3-methoxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
|---|---|
| PubChem CID | 24822731 |
| Molecular Formula | C12H16O4 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | (1S,5R,6S)-5-hydroxy-3-[(E)-3-methoxy-3-methylbut-1-enyl]-7-oxabicyclo[4.1.0]hept-3-en-2-one |
| SMILES | COC(C)(C)/C=C/C1=C[C@@H](O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C12H16O4/c1-12(2,15-3)5-4-7-6-8(13)10-11(16-10)9(7)14/h4-6,8,10-11,13H,1-3H3/b5-4+/t8-,10+,11-/m1/s1 |
| InChIKey | KZVFQSBTQUJJFF-MZGDZVRXSA-N |
| XLogP | 0.61 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|