C14H10Cl2N4 — CID 24822757
7-(2,6-dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine (PubChem CID 24822757) has the molecular formula C14H10Cl2N4 and a molecular weight of 305.17 g/mol. Its IUPAC name is 7-(2,6-dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine.
| Compound Name | 7-(2,6-dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
|---|---|
| PubChem CID | 24822757 |
| Molecular Formula | C14H10Cl2N4 |
| Molecular Weight | 305.17 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 7-(2,6-dichlorophenyl)-5-methyl-1,2,4-benzotriazin-3-amine |
| SMILES | Cc1cc(-c2c(Cl)cccc2Cl)cc2nnc(N)nc12 |
| InChI | InChI=1S/C14H10Cl2N4/c1-7-5-8(12-9(15)3-2-4-10(12)16)6-11-13(7)18-14(17)20-19-11/h2-6H,1H3,(H2,17,18,20) |
| InChIKey | VIPXIJIKXLCFJS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.17 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |