C25H29NO5 — CID 24822989
(6E,12E)-16,18-dihydroxy-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one (PubChem CID 24822989) has the molecular formula C25H29NO5 and a molecular weight of 423.51 g/mol. Its IUPAC name is (6E,12E)-16,18-dihydroxy-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one.
| Compound Name | (6E,12E)-16,18-dihydroxy-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
|---|---|
| PubChem CID | 24822989 |
| Molecular Formula | C25H29NO5 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | (6E,12E)-16,18-dihydroxy-4-methyl-12-phenylmethoxyimino-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraen-2-one |
| SMILES | CC1C/C=C/CCCC/C(=N\OCc2ccccc2)Cc2cc(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C25H29NO5/c1-18-10-6-3-2-4-9-13-21(26-30-17-19-11-7-5-8-12-19)14-20-15-22(27)16-23(28)24(20)25(29)31-18/h3,5-8,11-12,15-16,18,27-28H,2,4,9-10,13-14,17H2,1H3/b6-3+,26-21+ |
| InChIKey | IWYKAOQAMQQSDU-OBVWITOVSA-N |
| XLogP | 5.28 |
| TPSA | 88.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|