About N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide
N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide (PubChem CID 24823093) has the molecular formula C24H21N3O4
and a molecular weight of 415.45 g/mol. Its IUPAC name is N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide.
Molecular Properties
| Compound Name | N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide |
| PubChem CID | 24823093 |
| Molecular Formula | C24H21N3O4 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide |
| SMILES | COc1cc2ncnc(Oc3ccc4c(C(=O)NC5CC5)cccc4c3)c2cc1OC |
| InChI | InChI=1S/C24H21N3O4/c1-29-21-11-19-20(12-22(21)30-2)25-13-26-24(19)31-16-8-9-17-14(10-16)4-3-5-18(17)23(28)27-15-6-7-15/h3-5,8-13,15H,6-7H2,1-2H3,(H,27,28) |
| InChIKey | JLBAXNKYJZOYGQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide?
The IUPAC name of N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide (CID 24823093) is N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide.
What is the SMILES notation for N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide?
The canonical SMILES for N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide is COc1cc2ncnc(Oc3ccc4c(C(=O)NC5CC5)cccc4c3)c2cc1OC.
What is the InChIKey of N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide?
The InChIKey is JLBAXNKYJZOYGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21N3O4/c1-29-21-11-19-20(12-22(21)30-2)25-13-26-24(19)31-16-8-9-17-14(10-16)4-3-5-18(17)23(28)27-15-6-7-15/h3-5,8-13,15H,6-7H2,1-2H3,(H,27,28).
What are the key properties of N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide?
N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide has a molecular weight of 415.45 g/mol, XLogP of 4.48, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopropyl-6-(6,7-dimethoxyquinazolin-4-yl)oxynaphthalene-1-carboxamide is sourced from PubChem (CID 24823093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).