About 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol
2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol (PubChem CID 24823181) has the molecular formula C22H21N5OS
and a molecular weight of 403.51 g/mol. Its IUPAC name is 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol.
Molecular Properties
| Compound Name | 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol |
| PubChem CID | 24823181 |
| Molecular Formula | C22H21N5OS |
| Molecular Weight | 403.51 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol |
| SMILES | Cc1nc(-c2cccc(Nc3nccc(NCC(O)c4ccccc4)n3)c2)cs1 |
| InChI | InChI=1S/C22H21N5OS/c1-15-25-19(14-29-15)17-8-5-9-18(12-17)26-22-23-11-10-21(27-22)24-13-20(28)16-6-3-2-4-7-16/h2-12,14,20,28H,13H2,1H3,(H2,23,24,26,27) |
| InChIKey | OVYXTUYDCGLOTM-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.51 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol?
The IUPAC name of 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol (CID 24823181) is 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol.
What is the SMILES notation for 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol?
The canonical SMILES for 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol is Cc1nc(-c2cccc(Nc3nccc(NCC(O)c4ccccc4)n3)c2)cs1.
What is the InChIKey of 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol?
The InChIKey is OVYXTUYDCGLOTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21N5OS/c1-15-25-19(14-29-15)17-8-5-9-18(12-17)26-22-23-11-10-21(27-22)24-13-20(28)16-6-3-2-4-7-16/h2-12,14,20,28H,13H2,1H3,(H2,23,24,26,27).
What are the key properties of 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol?
2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol has a molecular weight of 403.51 g/mol, XLogP of 4.80, 7 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[3-(2-methyl-1,3-thiazol-4-yl)anilino]pyrimidin-4-yl]amino]-1-phenylethanol is sourced from PubChem (CID 24823181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).