C26H29N3O6S — CID 24823240
dimethyl 4-[6-(2,5-dimethoxyphenyl)-2-ethylimidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 24823240) has the molecular formula C26H29N3O6S and a molecular weight of 511.60 g/mol. Its IUPAC name is dimethyl 4-[6-(2,5-dimethoxyphenyl)-2-ethylimidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 4-[6-(2,5-dimethoxyphenyl)-2-ethylimidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24823240 |
| Molecular Formula | C26H29N3O6S |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | dimethyl 4-[6-(2,5-dimethoxyphenyl)-2-ethylimidazo[2,1-b][1,3]thiazol-5-yl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCc1cn2c(C3C(C(=O)OC)=C(C)NC(C)=C3C(=O)OC)c(-c3cc(OC)ccc3OC)nc2s1 |
| InChI | InChI=1S/C26H29N3O6S/c1-8-16-12-29-23(21-19(24(30)34-6)13(2)27-14(3)20(21)25(31)35-7)22(28-26(29)36-16)17-11-15(32-4)9-10-18(17)33-5/h9-12,21,27H,8H2,1-7H3 |
| InChIKey | FZBCKVOWBSRUGY-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |