C25H27N3O7S — CID 24823723
dimethyl 2,6-dimethyl-4-[6-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 24823723) has the molecular formula C25H27N3O7S and a molecular weight of 513.57 g/mol. Its IUPAC name is dimethyl 2,6-dimethyl-4-[6-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-dimethyl-4-[6-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 24823723 |
| Molecular Formula | C25H27N3O7S |
| Molecular Weight | 513.57 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | dimethyl 2,6-dimethyl-4-[6-(3,4,5-trimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1c(-c2cc(OC)c(OC)c(OC)c2)nc2sccn12 |
| InChI | InChI=1S/C25H27N3O7S/c1-12-17(23(29)34-6)19(18(13(2)26-12)24(30)35-7)21-20(27-25-28(21)8-9-36-25)14-10-15(31-3)22(33-5)16(11-14)32-4/h8-11,19,26H,1-7H3 |
| InChIKey | GFECPSWGPHZOLX-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.57 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |