About 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one
6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one (PubChem CID 24823752) has the molecular formula C14H15Cl2N3OS
and a molecular weight of 344.27 g/mol. Its IUPAC name is 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one.
Molecular Properties
| Compound Name | 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one |
| PubChem CID | 24823752 |
| Molecular Formula | C14H15Cl2N3OS |
| Molecular Weight | 344.27 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one |
| SMILES | CCCSc1nc(N)cc(=O)n1Cc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C14H15Cl2N3OS/c1-2-5-21-14-18-12(17)7-13(20)19(14)8-9-3-4-10(15)6-11(9)16/h3-4,6-7H,2,5,8,17H2,1H3 |
| InChIKey | LGYSJBLMZKZYRU-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.27 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one?
The IUPAC name of 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one (CID 24823752) is 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one.
What is the SMILES notation for 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one?
The canonical SMILES for 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one is CCCSc1nc(N)cc(=O)n1Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one?
The InChIKey is LGYSJBLMZKZYRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15Cl2N3OS/c1-2-5-21-14-18-12(17)7-13(20)19(14)8-9-3-4-10(15)6-11(9)16/h3-4,6-7H,2,5,8,17H2,1H3.
What are the key properties of 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one?
6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one has a molecular weight of 344.27 g/mol, XLogP of 3.68, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-3-[(2,4-dichlorophenyl)methyl]-2-propylsulfanylpyrimidin-4-one is sourced from PubChem (CID 24823752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).