C26H25ClN4O2 — CID 24823989
2-(4-benzhydrylpiperazin-1-yl)-N-(5-chloro-1,3-benzoxazol-2-yl)acetamide (PubChem CID 24823989) has the molecular formula C26H25ClN4O2 and a molecular weight of 460.97 g/mol. Its IUPAC name is 2-(4-benzhydrylpiperazin-1-yl)-N-(5-chloro-1,3-benzoxazol-2-yl)acetamide.
| Compound Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(5-chloro-1,3-benzoxazol-2-yl)acetamide |
|---|---|
| PubChem CID | 24823989 |
| Molecular Formula | C26H25ClN4O2 |
| Molecular Weight | 460.97 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | 2-(4-benzhydrylpiperazin-1-yl)-N-(5-chloro-1,3-benzoxazol-2-yl)acetamide |
| SMILES | O=C(CN1CCN(C(c2ccccc2)c2ccccc2)CC1)Nc1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C26H25ClN4O2/c27-21-11-12-23-22(17-21)28-26(33-23)29-24(32)18-30-13-15-31(16-14-30)25(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,17,25H,13-16,18H2,(H,28,29,32) |
| InChIKey | DSLUBKMUYGWWLC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 61.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.97 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |