C41H47ClN2O5 — CID 24824244
2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 24824244) has the molecular formula C41H47ClN2O5 and a molecular weight of 683.29 g/mol. Its IUPAC name is 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 24824244 |
| Molecular Formula | C41H47ClN2O5 |
| Molecular Weight | 683.29 g/mol |
| Exact Mass | 682.32 |
| IUPAC Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl (2Z,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCOC(=O)/C=C(C)\C=C\C=C(C)\C=C\C1=C(C)CCCC1(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C41H47ClN2O5/c1-27(13-19-36-29(3)12-9-21-41(36,5)6)10-8-11-28(2)24-39(46)49-23-22-43-38(45)26-34-30(4)44(37-20-18-33(48-7)25-35(34)37)40(47)31-14-16-32(42)17-15-31/h8,10-11,13-20,24-25H,9,12,21-23,26H2,1-7H3,(H,43,45)/b11-8+,19-13+,27-10+,28-24- |
| InChIKey | GIJZHRLBXSXVIO-NZORCCBFSA-N |
| XLogP | 9.03 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.29 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|