C18H21ClO5 — CID 24824498
(4R,6E)-15-chloro-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione (PubChem CID 24824498) has the molecular formula C18H21ClO5 and a molecular weight of 352.81 g/mol. Its IUPAC name is (4R,6E)-15-chloro-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione.
| Compound Name | (4R,6E)-15-chloro-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione |
|---|---|
| PubChem CID | 24824498 |
| Molecular Formula | C18H21ClO5 |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | (4R,6E)-15-chloro-16,18-dihydroxy-4-methyl-3-oxabicyclo[12.4.0]octadeca-1(14),6,15,17-tetraene-2,12-dione |
| SMILES | C[C@@H]1C/C=C/CCCCC(=O)Cc2c(Cl)c(O)cc(O)c2C(=O)O1 |
| InChI | InChI=1S/C18H21ClO5/c1-11-7-5-3-2-4-6-8-12(20)9-13-16(18(23)24-11)14(21)10-15(22)17(13)19/h3,5,10-11,21-22H,2,4,6-9H2,1H3/b5-3+/t11-/m1/s1 |
| InChIKey | MAIXLHSZNVDUIV-JOAKQRRISA-N |
| XLogP | 3.93 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|