C16H14O4 — CID 24824608
8-methoxy-2,2-dimethylbenzo[g]chromene-5,10-dione (PubChem CID 24824608) has the molecular formula C16H14O4 and a molecular weight of 270.28 g/mol. Its IUPAC name is 8-methoxy-2,2-dimethylbenzo[g]chromene-5,10-dione.
| Compound Name | 8-methoxy-2,2-dimethylbenzo[g]chromene-5,10-dione |
|---|---|
| PubChem CID | 24824608 |
| Molecular Formula | C16H14O4 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | 8-methoxy-2,2-dimethylbenzo[g]chromene-5,10-dione |
| SMILES | COc1ccc2c(c1)C(=O)C1=C(C=CC(C)(C)O1)C2=O |
| InChI | InChI=1S/C16H14O4/c1-16(2)7-6-11-13(17)10-5-4-9(19-3)8-12(10)14(18)15(11)20-16/h4-8H,1-3H3 |
| InChIKey | KQTMGUXETRTTJB-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|