About N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide
N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide (PubChem CID 24825406) has the molecular formula C29H34N2O4S
and a molecular weight of 506.67 g/mol. Its IUPAC name is N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide.
Molecular Properties
| Compound Name | N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
| PubChem CID | 24825406 |
| Molecular Formula | C29H34N2O4S |
| Molecular Weight | 506.67 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide |
| SMILES | CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3cc(OC)ccc3OC)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H34N2O4S/c1-4-5-6-9-21-12-15-23(16-13-21)36(32,33)30-19-18-25-24-10-7-8-11-27(24)31-29(25)26-20-22(34-2)14-17-28(26)35-3/h7-8,10-17,20,30-31H,4-6,9,18-19H2,1-3H3 |
| InChIKey | ZGCVIPCIKJCJJQ-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.67 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide?
The IUPAC name of N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide (CID 24825406) is N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide.
What is the SMILES notation for N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide?
The canonical SMILES for N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide is CCCCCc1ccc(S(=O)(=O)NCCc2c(-c3cc(OC)ccc3OC)[nH]c3ccccc23)cc1.
What is the InChIKey of N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide?
The InChIKey is ZGCVIPCIKJCJJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H34N2O4S/c1-4-5-6-9-21-12-15-23(16-13-21)36(32,33)30-19-18-25-24-10-7-8-11-27(24)31-29(25)26-20-22(34-2)14-17-28(26)35-3/h7-8,10-17,20,30-31H,4-6,9,18-19H2,1-3H3.
What are the key properties of N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide?
N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide has a molecular weight of 506.67 g/mol, XLogP of 6.11, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2-(2,5-dimethoxyphenyl)-1H-indol-3-yl]ethyl]-4-pentylbenzenesulfonamide is sourced from PubChem (CID 24825406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).