C26H31N — CID 24825426
(3aS,6aR)-5-[(E)-hex-3-en-3-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine (PubChem CID 24825426) has the molecular formula C26H31N and a molecular weight of 357.54 g/mol. Its IUPAC name is (3aS,6aR)-5-[(E)-hex-3-en-3-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine.
| Compound Name | (3aS,6aR)-5-[(E)-hex-3-en-3-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
|---|---|
| PubChem CID | 24825426 |
| Molecular Formula | C26H31N |
| Molecular Weight | 357.54 g/mol |
| Exact Mass | 357.25 |
| IUPAC Name | (3aS,6aR)-5-[(E)-hex-3-en-3-yl]-N,4-diphenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
| SMILES | CC/C=C(\CC)C1=C(c2ccccc2)[C@]2(Nc3ccccc3)CCC[C@@H]2C1 |
| InChI | InChI=1S/C26H31N/c1-3-12-20(4-2)24-19-22-15-11-18-26(22,27-23-16-9-6-10-17-23)25(24)21-13-7-5-8-14-21/h5-10,12-14,16-17,22,27H,3-4,11,15,18-19H2,1-2H3/b20-12+/t22-,26+/m1/s1 |
| InChIKey | RGQUUOPHRNPGLR-MHCWBMQKSA-N |
| XLogP | 7.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |