C28H37N — CID 24825437
(3aS,6aR)-N-(2,3-dimethylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine (PubChem CID 24825437) has the molecular formula C28H37N and a molecular weight of 387.61 g/mol. Its IUPAC name is (3aS,6aR)-N-(2,3-dimethylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine.
| Compound Name | (3aS,6aR)-N-(2,3-dimethylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
|---|---|
| PubChem CID | 24825437 |
| Molecular Formula | C28H37N |
| Molecular Weight | 387.61 g/mol |
| Exact Mass | 387.29 |
| IUPAC Name | (3aS,6aR)-N-(2,3-dimethylphenyl)-5-hexyl-4-phenyl-2,3,6,6a-tetrahydro-1H-pentalen-3a-amine |
| SMILES | CCCCCCC1=C(c2ccccc2)[C@]2(Nc3cccc(C)c3C)CCC[C@@H]2C1 |
| InChI | InChI=1S/C28H37N/c1-4-5-6-8-16-24-20-25-17-12-19-28(25,27(24)23-14-9-7-10-15-23)29-26-18-11-13-21(2)22(26)3/h7,9-11,13-15,18,25,29H,4-6,8,12,16-17,19-20H2,1-3H3/t25-,28+/m1/s1 |
| InChIKey | SUVVTAUKFUDGSY-NAKRPHOHSA-N |
| XLogP | 8.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.61 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|