About 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole
2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole (PubChem CID 24825519) has the molecular formula C15H17N3O
and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole.
Molecular Properties
| Compound Name | 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| PubChem CID | 24825519 |
| Molecular Formula | C15H17N3O |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole |
| SMILES | CC1(C)COC(c2ccc(Cc3cnc[nH]3)cc2)=N1 |
| InChI | InChI=1S/C15H17N3O/c1-15(2)9-19-14(18-15)12-5-3-11(4-6-12)7-13-8-16-10-17-13/h3-6,8,10H,7,9H2,1-2H3,(H,16,17) |
| InChIKey | NSUJUQRJDQTZEV-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 50.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole?
The IUPAC name of 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole (CID 24825519) is 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole.
What is the SMILES notation for 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole?
The canonical SMILES for 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole is CC1(C)COC(c2ccc(Cc3cnc[nH]3)cc2)=N1.
What is the InChIKey of 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole?
The InChIKey is NSUJUQRJDQTZEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17N3O/c1-15(2)9-19-14(18-15)12-5-3-11(4-6-12)7-13-8-16-10-17-13/h3-6,8,10H,7,9H2,1-2H3,(H,16,17).
What are the key properties of 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole?
2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole has a molecular weight of 255.32 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(1H-imidazol-5-ylmethyl)phenyl]-4,4-dimethyl-5H-1,3-oxazole is sourced from PubChem (CID 24825519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).