About N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide
N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide (PubChem CID 24825636) has the molecular formula C17H17Cl3N2O
and a molecular weight of 371.70 g/mol. Its IUPAC name is N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide.
Molecular Properties
| Compound Name | N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide |
| PubChem CID | 24825636 |
| Molecular Formula | C17H17Cl3N2O |
| Molecular Weight | 371.70 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide |
| SMILES | Cc1ccc(Cl)c(Nc2ccccc2C(=O)NCCCCl)c1Cl |
| InChI | InChI=1S/C17H17Cl3N2O/c1-11-7-8-13(19)16(15(11)20)22-14-6-3-2-5-12(14)17(23)21-10-4-9-18/h2-3,5-8,22H,4,9-10H2,1H3,(H,21,23) |
| InChIKey | JMRUQNZCPMKHCP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide?
The IUPAC name of N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide (CID 24825636) is N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide.
What is the SMILES notation for N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide?
The canonical SMILES for N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide is Cc1ccc(Cl)c(Nc2ccccc2C(=O)NCCCCl)c1Cl.
What is the InChIKey of N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide?
The InChIKey is JMRUQNZCPMKHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17Cl3N2O/c1-11-7-8-13(19)16(15(11)20)22-14-6-3-2-5-12(14)17(23)21-10-4-9-18/h2-3,5-8,22H,4,9-10H2,1H3,(H,21,23).
What are the key properties of N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide?
N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide has a molecular weight of 371.70 g/mol, XLogP of 5.40, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-chloropropyl)-2-(2,6-dichloro-3-methylanilino)benzamide is sourced from PubChem (CID 24825636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).