C20H25N5O2S — CID 24825745
N-[3-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methanesulfonamide (PubChem CID 24825745) has the molecular formula C20H25N5O2S and a molecular weight of 399.52 g/mol. Its IUPAC name is N-[3-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methanesulfonamide.
| Compound Name | N-[3-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 24825745 |
| Molecular Formula | C20H25N5O2S |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | N-[3-[[3-(1H-indazol-5-ylamino)piperidin-1-yl]methyl]phenyl]methanesulfonamide |
| SMILES | CS(=O)(=O)Nc1cccc(CN2CCCC(Nc3ccc4[nH]ncc4c3)C2)c1 |
| InChI | InChI=1S/C20H25N5O2S/c1-28(26,27)24-18-5-2-4-15(10-18)13-25-9-3-6-19(14-25)22-17-7-8-20-16(11-17)12-21-23-20/h2,4-5,7-8,10-12,19,22,24H,3,6,9,13-14H2,1H3,(H,21,23) |
| InChIKey | VYDWBAYBPOUUPX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |