About 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine
3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine (PubChem CID 24825871) has the molecular formula C21H21FN6O
and a molecular weight of 392.44 g/mol. Its IUPAC name is 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine |
| PubChem CID | 24825871 |
| Molecular Formula | C21H21FN6O |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine |
| SMILES | CCc1nn(C2CCOCC2)c2nc(-c3ccnn3-c3cccc(F)n3)ccc12 |
| InChI | InChI=1S/C21H21FN6O/c1-2-16-15-6-7-17(24-21(15)27(26-16)14-9-12-29-13-10-14)18-8-11-23-28(18)20-5-3-4-19(22)25-20/h3-8,11,14H,2,9-10,12-13H2,1H3 |
| InChIKey | RBVFBVNZCBGIJH-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine?
The IUPAC name of 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine (CID 24825871) is 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine.
What is the SMILES notation for 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine?
The canonical SMILES for 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine is CCc1nn(C2CCOCC2)c2nc(-c3ccnn3-c3cccc(F)n3)ccc12.
What is the InChIKey of 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine?
The InChIKey is RBVFBVNZCBGIJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21FN6O/c1-2-16-15-6-7-17(24-21(15)27(26-16)14-9-12-29-13-10-14)18-8-11-23-28(18)20-5-3-4-19(22)25-20/h3-8,11,14H,2,9-10,12-13H2,1H3.
What are the key properties of 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine?
3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine has a molecular weight of 392.44 g/mol, XLogP of 3.73, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6-[2-(6-fluoro-2-pyridinyl)pyrazol-3-yl]-1-(oxan-4-yl)pyrazolo[3,4-b]pyridine is sourced from PubChem (CID 24825871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).