C42H45N5O7S — CID 24826323
N-[3,5-bis[(2-methoxy-8-methylidene-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxymethyl]phenyl]-4-methyl-4-sulfanylpentanamide (PubChem CID 24826323) has the molecular formula C42H45N5O7S and a molecular weight of 763.92 g/mol. Its IUPAC name is N-[3,5-bis[(2-methoxy-8-methylidene-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxymethyl]phenyl]-4-methyl-4-sulfanylpentanamide.
| Compound Name | N-[3,5-bis[(2-methoxy-8-methylidene-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxymethyl]phenyl]-4-methyl-4-sulfanylpentanamide |
|---|---|
| PubChem CID | 24826323 |
| Molecular Formula | C42H45N5O7S |
| Molecular Weight | 763.92 g/mol |
| Exact Mass | 763.30 |
| IUPAC Name | N-[3,5-bis[(2-methoxy-8-methylidene-11-oxo-7,9-dihydro-6aH-pyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxymethyl]phenyl]-4-methyl-4-sulfanylpentanamide |
| SMILES | C=C1CC2C=Nc3cc(OCc4cc(COc5cc6c(cc5OC)C(=O)N5CC(=C)CC5C=N6)cc(NC(=O)CCC(C)(C)S)c4)c(OC)cc3C(=O)N2C1 |
| InChI | InChI=1S/C42H45N5O7S/c1-24-9-29-18-43-33-16-37(35(51-5)14-31(33)40(49)46(29)20-24)53-22-26-11-27(13-28(12-26)45-39(48)7-8-42(3,4)55)23-54-38-17-34-32(15-36(38)52-6)41(50)47-21-25(2)10-30(47)19-44-34/h11-19,29-30,55H,1-2,7-10,20-23H2,3-6H3,(H,45,48) |
| InChIKey | WNZGZSGUDSYEMD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.92 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|