C31H47ClN4O3 — CID 24826348
(2S,4S)-1-[(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]-4-[(4,4-dimethylcyclohexyl)-(2,2-dimethylpropanoyl)amino]-N,N-dimethylpyrrolidine-2-carboxamide (PubChem CID 24826348) has the molecular formula C31H47ClN4O3 and a molecular weight of 559.20 g/mol. Its IUPAC name is (2S,4S)-1-[(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]-4-[(4,4-dimethylcyclohexyl)-(2,2-dimethylpropanoyl)amino]-N,N-dimethylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]-4-[(4,4-dimethylcyclohexyl)-(2,2-dimethylpropanoyl)amino]-N,N-dimethylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 24826348 |
| Molecular Formula | C31H47ClN4O3 |
| Molecular Weight | 559.20 g/mol |
| Exact Mass | 558.33 |
| IUPAC Name | (2S,4S)-1-[(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]-4-[(4,4-dimethylcyclohexyl)-(2,2-dimethylpropanoyl)amino]-N,N-dimethylpyrrolidine-2-carboxamide |
| SMILES | CN(C)C(=O)[C@@H]1C[C@H](N(C(=O)C(C)(C)C)C2CCC(C)(C)CC2)CN1C(=O)[C@@H]1CNC[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H47ClN4O3/c1-30(2,3)29(39)36(22-12-14-31(4,5)15-13-22)23-16-26(28(38)34(6)7)35(19-23)27(37)25-18-33-17-24(25)20-8-10-21(32)11-9-20/h8-11,22-26,33H,12-19H2,1-7H3/t23-,24-,25+,26-/m0/s1 |
| InChIKey | ICNSOVYFCPSBNZ-SSUZURRFSA-N |
| XLogP | 4.54 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.20 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |