C32H28N4O2 — CID 24826905
2-[6-(cyclopropyloxymethyl)-9-(3-hydroxy-3-methylbutyl)-3H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile (PubChem CID 24826905) has the molecular formula C32H28N4O2 and a molecular weight of 500.60 g/mol. Its IUPAC name is 2-[6-(cyclopropyloxymethyl)-9-(3-hydroxy-3-methylbutyl)-3H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile.
| Compound Name | 2-[6-(cyclopropyloxymethyl)-9-(3-hydroxy-3-methylbutyl)-3H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 24826905 |
| Molecular Formula | C32H28N4O2 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | 2-[6-(cyclopropyloxymethyl)-9-(3-hydroxy-3-methylbutyl)-3H-phenanthro[9,10-d]imidazol-2-yl]benzene-1,3-dicarbonitrile |
| SMILES | CC(C)(O)CCc1ccc2c(c1)c1cc(COC3CC3)ccc1c1[nH]c(-c3c(C#N)cccc3C#N)nc21 |
| InChI | InChI=1S/C32H28N4O2/c1-32(2,37)13-12-19-6-10-24-26(14-19)27-15-20(18-38-23-8-9-23)7-11-25(27)30-29(24)35-31(36-30)28-21(16-33)4-3-5-22(28)17-34/h3-7,10-11,14-15,23,37H,8-9,12-13,18H2,1-2H3,(H,35,36) |
| InChIKey | NSXHLDQSHDDWPC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 105.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|