C14H18N2O2 — CID 24826957
(11aR)-10-methoxy-7-methyl-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one (PubChem CID 24826957) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is (11aR)-10-methoxy-7-methyl-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one.
| Compound Name | (11aR)-10-methoxy-7-methyl-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
|---|---|
| PubChem CID | 24826957 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | (11aR)-10-methoxy-7-methyl-1,2,3,4,11,11a-hexahydropyrazino[1,2-b]isoquinolin-6-one |
| SMILES | COc1ccc(C)c2c1C[C@@H]1CNCCN1C2=O |
| InChI | InChI=1S/C14H18N2O2/c1-9-3-4-12(18-2)11-7-10-8-15-5-6-16(10)14(17)13(9)11/h3-4,10,15H,5-8H2,1-2H3/t10-/m1/s1 |
| InChIKey | HATSPAUQABBECE-SNVBAGLBSA-N |
| XLogP | 0.97 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |