C29H26F3N5O — CID 24826975
3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]benzamide (PubChem CID 24826975) has the molecular formula C29H26F3N5O and a molecular weight of 517.56 g/mol. Its IUPAC name is 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 24826975 |
| Molecular Formula | C29H26F3N5O |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.21 |
| IUPAC Name | 3-(2-imidazo[1,2-a]pyridin-3-ylethynyl)-4-methyl-N-[4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(CN3CCNCC3)c(C(F)(F)F)c2)cc1C#Cc1cnc2ccccn12 |
| InChI | InChI=1S/C29H26F3N5O/c1-20-5-6-22(16-21(20)8-10-25-18-34-27-4-2-3-13-37(25)27)28(38)35-24-9-7-23(26(17-24)29(30,31)32)19-36-14-11-33-12-15-36/h2-7,9,13,16-18,33H,11-12,14-15,19H2,1H3,(H,35,38) |
| InChIKey | OMFSRNKSJGOABX-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 61.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|