About N,N-dimethylformamide;trichloroiron
N,N-dimethylformamide;trichloroiron (PubChem CID 24827207) has the molecular formula C3H7Cl3FeNO
and a molecular weight of 235.30 g/mol. Its IUPAC name is N,N-dimethylformamide;trichloroiron.
Molecular Properties
| Compound Name | N,N-dimethylformamide;trichloroiron |
| PubChem CID | 24827207 |
| Molecular Formula | C3H7Cl3FeNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 233.89 |
| IUPAC Name | N,N-dimethylformamide;trichloroiron |
| SMILES | CN(C)C=O.Cl[Fe](Cl)Cl |
| InChI | InChI=1S/C3H7NO.3ClH.Fe/c1-4(2)3-5;;;;/h3H,1-2H3;3*1H;/q;;;;+3/p-3 |
| InChIKey | IIJXZDGKCJTATK-UHFFFAOYSA-K |
| XLogP | 1.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N,N-dimethylformamide;trichloroiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethylformamide;trichloroiron?
The IUPAC name of N,N-dimethylformamide;trichloroiron (CID 24827207) is N,N-dimethylformamide;trichloroiron.
What is the SMILES notation for N,N-dimethylformamide;trichloroiron?
The canonical SMILES for N,N-dimethylformamide;trichloroiron is CN(C)C=O.Cl[Fe](Cl)Cl.
What is the InChIKey of N,N-dimethylformamide;trichloroiron?
The InChIKey is IIJXZDGKCJTATK-UHFFFAOYSA-K. The full InChI is InChI=1S/C3H7NO.3ClH.Fe/c1-4(2)3-5;;;;/h3H,1-2H3;3*1H;/q;;;;+3/p-3.
What are the key properties of N,N-dimethylformamide;trichloroiron?
N,N-dimethylformamide;trichloroiron has a molecular weight of 235.30 g/mol, XLogP of 1.77, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethylformamide;trichloroiron is sourced from PubChem (CID 24827207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).