About tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate
tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate (PubChem CID 24827314) has the molecular formula C17H19ClN2O4
and a molecular weight of 350.80 g/mol. Its IUPAC name is tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate.
Molecular Properties
| Compound Name | tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate |
| PubChem CID | 24827314 |
| Molecular Formula | C17H19ClN2O4 |
| Molecular Weight | 350.80 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate |
| SMILES | CC(C)(C)OC(=O)CN1C(=O)C2(CNC(=O)C2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C17H19ClN2O4/c1-16(2,3)24-14(22)8-20-12-5-4-10(18)6-11(12)17(15(20)23)7-13(21)19-9-17/h4-6H,7-9H2,1-3H3,(H,19,21) |
| InChIKey | VTOMBXZKTOLYLG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.80 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate?
The IUPAC name of tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate (CID 24827314) is tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate.
What is the SMILES notation for tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate?
The canonical SMILES for tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate is CC(C)(C)OC(=O)CN1C(=O)C2(CNC(=O)C2)c2cc(Cl)ccc21.
What is the InChIKey of tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate?
The InChIKey is VTOMBXZKTOLYLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19ClN2O4/c1-16(2,3)24-14(22)8-20-12-5-4-10(18)6-11(12)17(15(20)23)7-13(21)19-9-17/h4-6H,7-9H2,1-3H3,(H,19,21).
What are the key properties of tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate?
tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate has a molecular weight of 350.80 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-(5-chloro-2,2'-dioxospiro[indole-3,4'-pyrrolidine]-1-yl)acetate is sourced from PubChem (CID 24827314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).