C14H22O2 — CID 24827355
1-[(4R,5R,6S)-4,5,6-trimethyl-2,3,4,5,7,8-hexahydrochromen-6-yl]ethanone (PubChem CID 24827355) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is 1-[(4R,5R,6S)-4,5,6-trimethyl-2,3,4,5,7,8-hexahydrochromen-6-yl]ethanone.
| Compound Name | 1-[(4R,5R,6S)-4,5,6-trimethyl-2,3,4,5,7,8-hexahydrochromen-6-yl]ethanone |
|---|---|
| PubChem CID | 24827355 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 1-[(4R,5R,6S)-4,5,6-trimethyl-2,3,4,5,7,8-hexahydrochromen-6-yl]ethanone |
| SMILES | CC(=O)[C@@]1(C)CCC2=C([C@H](C)CCO2)[C@H]1C |
| InChI | InChI=1S/C14H22O2/c1-9-6-8-16-12-5-7-14(4,11(3)15)10(2)13(9)12/h9-10H,5-8H2,1-4H3/t9-,10-,14+/m1/s1 |
| InChIKey | NCJRJUMPAAIYGX-RULNRJAQSA-N |
| XLogP | 3.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |